Marvin 11051015192D 25 27 0 0 0 0 999 V2000 8.8088 -4.4643 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 9.5234 -4.0518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.8088 -6.9393 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 8.8088 -5.2893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.5234 -5.7018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.0944 -5.7018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.5234 -3.2268 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.0944 -4.0518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.0944 -6.5268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.5234 -6.5268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.8088 -7.7643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.5234 -8.1768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.5234 -9.0018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.2378 -4.4643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3799 -4.4643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.0944 -3.2268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.2378 -9.4143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.8088 -9.4143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6654 -4.0518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3799 -2.8143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.2378 -10.2393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.8088 -10.2393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6654 -3.2268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.5234 -10.6518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.9523 -4.0518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2 1 1 0 0 0 0 4 1 1 0 0 0 0 8 1 1 0 0 0 0 7 2 2 0 0 0 0 14 2 1 0 0 0 0 9 3 1 0 0 0 0 11 3 1 0 0 0 0 10 3 1 0 0 0 0 5 4 1 0 0 0 0 6 4 1 0 0 0 0 10 5 1 0 0 0 0 9 6 1 0 0 0 0 15 8 1 0 0 0 0 16 8 2 0 0 0 0 12 11 1 0 0 0 0 13 12 1 0 0 0 0 17 13 1 0 0 0 0 18 13 2 0 0 0 0 19 15 2 0 0 0 0 20 16 1 0 0 0 0 21 17 2 0 0 0 0 22 18 1 0 0 0 0 23 19 1 0 0 0 0 23 20 2 0 0 0 0 24 21 1 0 0 0 0 24 22 2 0 0 0 0 14 25 1 0 0 0 0 M END > CHEBI:119915 > fentanyl > A monocarboxylic acid amide resulting from the formal condensation of the aryl amino group of N-phenyl-1-(2-phenylethyl)piperidin-4-amine with propanoic acid. > 3 > CHEBI:310077; CHEBI:5012 > phentanyl; N-phenyl-N-(1-(2-phenylethyl)-4-piperidinyl)propanamide; N-phenethyl-4-(N-propionylanilino)piperidine; N-(1-phenethylpiperidin-4-yl)-N-phenylpropionamide; N-(1-phenethyl-piperidin-4-yl)-N-phenyl-propionamide; N-(1-phenethyl-4-piperidyl)propionanilide; N-(1-phenethyl-4-piperidinyl)-N-phenylpropionamide; 1-phenethyl-4-N-propionylanilinopiperidine; 1-phenethyl-4-(N-phenylpropionamido)piperidine > N-phenyl-N-[1-(2-phenylethyl)piperidin-4-yl]propanamide > fentanylum; fentanyl; fentanyl; fentanilo > Duragesic > C22H28N2O > 336.47050 > 336.22016 > 0 > CCC(=O)N(C1CCN(CC1)CCc1ccccc1)c1ccccc1 > InChI=1S/C22H28N2O/c1-2-22(25)24(20-11-7-4-8-12-20)21-14-17-23(18-15-21)16-13-19-9-5-3-6-10-19/h3-12,21H,2,13-18H2,1H3 > PJMPHNIQZUBGLI-UHFFFAOYSA-N > 437-38-7 > 494484 > 437-38-7 > DB00813 > D00320 > Fentanyl > 10987438; 11585443; 14698188; 16621415; 18462178; 18728103; 30176422; 30305277; 10669565 $$$$